C31H37N3O6S — CID 10167086
2-(benzenesulfonamido)-N-[1-(4-methoxyphenyl)-3,4-dioxo-4-(2-phenylethylamino)butan-2-yl]-4-methylpentanamide (PubChem CID 10167086) has the molecular formula C31H37N3O6S and a molecular weight of 579.72 g/mol. Its IUPAC name is 2-(benzenesulfonamido)-N-[1-(4-methoxyphenyl)-3,4-dioxo-4-(2-phenylethylamino)butan-2-yl]-4-methylpentanamide.
| Compound Name | 2-(benzenesulfonamido)-N-[1-(4-methoxyphenyl)-3,4-dioxo-4-(2-phenylethylamino)butan-2-yl]-4-methylpentanamide |
|---|---|
| PubChem CID | 10167086 |
| Molecular Formula | C31H37N3O6S |
| Molecular Weight | 579.72 g/mol |
| Exact Mass | 579.24 |
| IUPAC Name | 2-(benzenesulfonamido)-N-[1-(4-methoxyphenyl)-3,4-dioxo-4-(2-phenylethylamino)butan-2-yl]-4-methylpentanamide |
| SMILES | COc1ccc(CC(NC(=O)C(CC(C)C)NS(=O)(=O)c2ccccc2)C(=O)C(=O)NCCc2ccccc2)cc1 |
| InChI | InChI=1S/C31H37N3O6S/c1-22(2)20-28(34-41(38,39)26-12-8-5-9-13-26)30(36)33-27(21-24-14-16-25(40-3)17-15-24)29(35)31(37)32-19-18-23-10-6-4-7-11-23/h4-17,22,27-28,34H,18-21H2,1-3H3,(H,32,37)(H,33,36) |
| InChIKey | KPPLKZXOWPTTCD-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 130.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.72 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|