C32H36N2O6 — CID 169425989
(2E)-2-[(3,4-dihydroxyphenyl)methylidene]-N-[4-[2-(4-methoxyphenyl)ethylamino]-3,4-dioxo-1-phenylbutan-2-yl]hexanamide (PubChem CID 169425989) has the molecular formula C32H36N2O6 and a molecular weight of 544.65 g/mol. Its IUPAC name is (2E)-2-[(3,4-dihydroxyphenyl)methylidene]-N-[4-[2-(4-methoxyphenyl)ethylamino]-3,4-dioxo-1-phenylbutan-2-yl]hexanamide.
| Compound Name | (2E)-2-[(3,4-dihydroxyphenyl)methylidene]-N-[4-[2-(4-methoxyphenyl)ethylamino]-3,4-dioxo-1-phenylbutan-2-yl]hexanamide |
|---|---|
| PubChem CID | 169425989 |
| Molecular Formula | C32H36N2O6 |
| Molecular Weight | 544.65 g/mol |
| Exact Mass | 544.26 |
| IUPAC Name | (2E)-2-[(3,4-dihydroxyphenyl)methylidene]-N-[4-[2-(4-methoxyphenyl)ethylamino]-3,4-dioxo-1-phenylbutan-2-yl]hexanamide |
| SMILES | CCCC/C(=C\c1ccc(O)c(O)c1)C(=O)NC(Cc1ccccc1)C(=O)C(=O)NCCc1ccc(OC)cc1 |
| InChI | InChI=1S/C32H36N2O6/c1-3-4-10-25(19-24-13-16-28(35)29(36)21-24)31(38)34-27(20-23-8-6-5-7-9-23)30(37)32(39)33-18-17-22-11-14-26(40-2)15-12-22/h5-9,11-16,19,21,27,35-36H,3-4,10,17-18,20H2,1-2H3,(H,33,39)(H,34,38)/b25-19+ |
| InChIKey | KZNMRYDLAALRKX-NCELDCMTSA-N |
| XLogP | 4.34 |
| TPSA | 124.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.65 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|