C22H25NO2 — CID 87678280
2-[(2,4-dimethylphenyl)methylidene]-3-oxo-N-(3-phenylpropyl)butanamide (PubChem CID 87678280) has the molecular formula C22H25NO2 and a molecular weight of 335.45 g/mol. Its IUPAC name is 2-[(2,4-dimethylphenyl)methylidene]-3-oxo-N-(3-phenylpropyl)butanamide.
| Compound Name | 2-[(2,4-dimethylphenyl)methylidene]-3-oxo-N-(3-phenylpropyl)butanamide |
|---|---|
| PubChem CID | 87678280 |
| Molecular Formula | C22H25NO2 |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.19 |
| IUPAC Name | 2-[(2,4-dimethylphenyl)methylidene]-3-oxo-N-(3-phenylpropyl)butanamide |
| SMILES | CC(=O)C(=Cc1ccc(C)cc1C)C(=O)NCCCc1ccccc1 |
| InChI | InChI=1S/C22H25NO2/c1-16-11-12-20(17(2)14-16)15-21(18(3)24)22(25)23-13-7-10-19-8-5-4-6-9-19/h4-6,8-9,11-12,14-15H,7,10,13H2,1-3H3,(H,23,25) |
| InChIKey | VVCCBLCIVOFSEH-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|