C22H28N2O2 — CID 108965816
N-(2,4-dimethylphenyl)-2,2-dimethyl-N'-(3-phenylpropyl)propanediamide (PubChem CID 108965816) has the molecular formula C22H28N2O2 and a molecular weight of 352.48 g/mol. Its IUPAC name is N-(2,4-dimethylphenyl)-2,2-dimethyl-N'-(3-phenylpropyl)propanediamide.
| Compound Name | N-(2,4-dimethylphenyl)-2,2-dimethyl-N'-(3-phenylpropyl)propanediamide |
|---|---|
| PubChem CID | 108965816 |
| Molecular Formula | C22H28N2O2 |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.22 |
| IUPAC Name | N-(2,4-dimethylphenyl)-2,2-dimethyl-N'-(3-phenylpropyl)propanediamide |
| SMILES | Cc1ccc(NC(=O)C(C)(C)C(=O)NCCCc2ccccc2)c(C)c1 |
| InChI | InChI=1S/C22H28N2O2/c1-16-12-13-19(17(2)15-16)24-21(26)22(3,4)20(25)23-14-8-11-18-9-6-5-7-10-18/h5-7,9-10,12-13,15H,8,11,14H2,1-4H3,(H,23,25)(H,24,26) |
| InChIKey | YCTSEUAZTPCUFQ-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|