C23H30N2O2 — CID 108966190
N-benzyl-N'-(2,4-dimethylphenyl)-2,2-dimethyl-N-propan-2-ylpropanediamide (PubChem CID 108966190) has the molecular formula C23H30N2O2 and a molecular weight of 366.51 g/mol. Its IUPAC name is N-benzyl-N'-(2,4-dimethylphenyl)-2,2-dimethyl-N-propan-2-ylpropanediamide.
| Compound Name | N-benzyl-N'-(2,4-dimethylphenyl)-2,2-dimethyl-N-propan-2-ylpropanediamide |
|---|---|
| PubChem CID | 108966190 |
| Molecular Formula | C23H30N2O2 |
| Molecular Weight | 366.51 g/mol |
| Exact Mass | 366.23 |
| IUPAC Name | N-benzyl-N'-(2,4-dimethylphenyl)-2,2-dimethyl-N-propan-2-ylpropanediamide |
| SMILES | Cc1ccc(NC(=O)C(C)(C)C(=O)N(Cc2ccccc2)C(C)C)c(C)c1 |
| InChI | InChI=1S/C23H30N2O2/c1-16(2)25(15-19-10-8-7-9-11-19)22(27)23(5,6)21(26)24-20-13-12-17(3)14-18(20)4/h7-14,16H,15H2,1-6H3,(H,24,26) |
| InChIKey | GPHLJIUSBLHOEQ-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.51 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|