C25H28N2O3S — CID 18286925
2-[benzyl-(3,4-dimethylphenyl)sulfonylamino]-N-(2,4-dimethylphenyl)acetamide (PubChem CID 18286925) has the molecular formula C25H28N2O3S and a molecular weight of 436.58 g/mol. Its IUPAC name is 2-[benzyl-(3,4-dimethylphenyl)sulfonylamino]-N-(2,4-dimethylphenyl)acetamide.
| Compound Name | 2-[benzyl-(3,4-dimethylphenyl)sulfonylamino]-N-(2,4-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 18286925 |
| Molecular Formula | C25H28N2O3S |
| Molecular Weight | 436.58 g/mol |
| Exact Mass | 436.18 |
| IUPAC Name | 2-[benzyl-(3,4-dimethylphenyl)sulfonylamino]-N-(2,4-dimethylphenyl)acetamide |
| SMILES | Cc1ccc(NC(=O)CN(Cc2ccccc2)S(=O)(=O)c2ccc(C)c(C)c2)c(C)c1 |
| InChI | InChI=1S/C25H28N2O3S/c1-18-10-13-24(21(4)14-18)26-25(28)17-27(16-22-8-6-5-7-9-22)31(29,30)23-12-11-19(2)20(3)15-23/h5-15H,16-17H2,1-4H3,(H,26,28) |
| InChIKey | YTBCXJPPQGRTMJ-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.58 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |