C24H27N3O5S2 — CID 100789963
2-[benzyl-(4-methylphenyl)sulfonylamino]-N-[2-methyl-5-(methylsulfamoyl)phenyl]acetamide (PubChem CID 100789963) has the molecular formula C24H27N3O5S2 and a molecular weight of 501.63 g/mol. Its IUPAC name is 2-[benzyl-(4-methylphenyl)sulfonylamino]-N-[2-methyl-5-(methylsulfamoyl)phenyl]acetamide.
| Compound Name | 2-[benzyl-(4-methylphenyl)sulfonylamino]-N-[2-methyl-5-(methylsulfamoyl)phenyl]acetamide |
|---|---|
| PubChem CID | 100789963 |
| Molecular Formula | C24H27N3O5S2 |
| Molecular Weight | 501.63 g/mol |
| Exact Mass | 501.14 |
| IUPAC Name | 2-[benzyl-(4-methylphenyl)sulfonylamino]-N-[2-methyl-5-(methylsulfamoyl)phenyl]acetamide |
| SMILES | CNS(=O)(=O)c1ccc(C)c(NC(=O)CN(Cc2ccccc2)S(=O)(=O)c2ccc(C)cc2)c1 |
| InChI | InChI=1S/C24H27N3O5S2/c1-18-9-12-21(13-10-18)34(31,32)27(16-20-7-5-4-6-8-20)17-24(28)26-23-15-22(14-11-19(23)2)33(29,30)25-3/h4-15,25H,16-17H2,1-3H3,(H,26,28) |
| InChIKey | PTSBJHJYZRLXHA-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.63 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |