C21H27N3O2 — CID 108963371
N-benzyl-2,2-dimethyl-N-propan-2-yl-N'-(pyridin-2-ylmethyl)propanediamide (PubChem CID 108963371) has the molecular formula C21H27N3O2 and a molecular weight of 353.47 g/mol. Its IUPAC name is N-benzyl-2,2-dimethyl-N-propan-2-yl-N'-(pyridin-2-ylmethyl)propanediamide.
| Compound Name | N-benzyl-2,2-dimethyl-N-propan-2-yl-N'-(pyridin-2-ylmethyl)propanediamide |
|---|---|
| PubChem CID | 108963371 |
| Molecular Formula | C21H27N3O2 |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.21 |
| IUPAC Name | N-benzyl-2,2-dimethyl-N-propan-2-yl-N'-(pyridin-2-ylmethyl)propanediamide |
| SMILES | CC(C)N(Cc1ccccc1)C(=O)C(C)(C)C(=O)NCc1ccccn1 |
| InChI | InChI=1S/C21H27N3O2/c1-16(2)24(15-17-10-6-5-7-11-17)20(26)21(3,4)19(25)23-14-18-12-8-9-13-22-18/h5-13,16H,14-15H2,1-4H3,(H,23,25) |
| InChIKey | ZVNZYLMGJJVUIH-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|