C25H26N2O2S — CID 87995977
O-[2-(2,4-dimethylanilino)-2-oxoethyl] N,N-dibenzylcarbamothioate (PubChem CID 87995977) has the molecular formula C25H26N2O2S and a molecular weight of 418.56 g/mol. Its IUPAC name is O-[2-(2,4-dimethylanilino)-2-oxoethyl] N,N-dibenzylcarbamothioate.
| Compound Name | O-[2-(2,4-dimethylanilino)-2-oxoethyl] N,N-dibenzylcarbamothioate |
|---|---|
| PubChem CID | 87995977 |
| Molecular Formula | C25H26N2O2S |
| Molecular Weight | 418.56 g/mol |
| Exact Mass | 418.17 |
| IUPAC Name | O-[2-(2,4-dimethylanilino)-2-oxoethyl] N,N-dibenzylcarbamothioate |
| SMILES | Cc1ccc(NC(=O)COC(=S)N(Cc2ccccc2)Cc2ccccc2)c(C)c1 |
| InChI | InChI=1S/C25H26N2O2S/c1-19-13-14-23(20(2)15-19)26-24(28)18-29-25(30)27(16-21-9-5-3-6-10-21)17-22-11-7-4-8-12-22/h3-15H,16-18H2,1-2H3,(H,26,28) |
| InChIKey | ABBSMTNLDFKOQM-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.56 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|