C26H29N3O3S2 — CID 87995976
carbamothioic S-acid;O-[2-(2,4-dimethylanilino)-2-oxoethyl] N,N-dibenzylcarbamothioate (PubChem CID 87995976) has the molecular formula C26H29N3O3S2 and a molecular weight of 495.67 g/mol. Its IUPAC name is carbamothioic S-acid;O-[2-(2,4-dimethylanilino)-2-oxoethyl] N,N-dibenzylcarbamothioate.
| Compound Name | carbamothioic S-acid;O-[2-(2,4-dimethylanilino)-2-oxoethyl] N,N-dibenzylcarbamothioate |
|---|---|
| PubChem CID | 87995976 |
| Molecular Formula | C26H29N3O3S2 |
| Molecular Weight | 495.67 g/mol |
| Exact Mass | 495.17 |
| IUPAC Name | carbamothioic S-acid;O-[2-(2,4-dimethylanilino)-2-oxoethyl] N,N-dibenzylcarbamothioate |
| SMILES | Cc1ccc(NC(=O)COC(=S)N(Cc2ccccc2)Cc2ccccc2)c(C)c1.NC(=O)S |
| InChI | InChI=1S/C25H26N2O2S.CH3NOS/c1-19-13-14-23(20(2)15-19)26-24(28)18-29-25(30)27(16-21-9-5-3-6-10-21)17-22-11-7-4-8-12-22;2-1(3)4/h3-15H,16-18H2,1-2H3,(H,26,28);(H3,2,3,4) |
| InChIKey | JMYZXCBSWKBADE-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.67 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|