C20H14Cl2N2O2S — CID 2455673
N,N'-bis(3-chlorophenyl)-2-(thiophen-2-ylmethylidene)propanediamide (PubChem CID 2455673) has the molecular formula C20H14Cl2N2O2S and a molecular weight of 417.32 g/mol. Its IUPAC name is N,N'-bis(3-chlorophenyl)-2-(thiophen-2-ylmethylidene)propanediamide.
| Compound Name | N,N'-bis(3-chlorophenyl)-2-(thiophen-2-ylmethylidene)propanediamide |
|---|---|
| PubChem CID | 2455673 |
| Molecular Formula | C20H14Cl2N2O2S |
| Molecular Weight | 417.32 g/mol |
| Exact Mass | 416.02 |
| IUPAC Name | N,N'-bis(3-chlorophenyl)-2-(thiophen-2-ylmethylidene)propanediamide |
| SMILES | O=C(Nc1cccc(Cl)c1)C(=Cc1cccs1)C(=O)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C20H14Cl2N2O2S/c21-13-4-1-6-15(10-13)23-19(25)18(12-17-8-3-9-27-17)20(26)24-16-7-2-5-14(22)11-16/h1-12H,(H,23,25)(H,24,26) |
| InChIKey | IXEQHADEERPCSI-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.32 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|