C11H10N2O2 — CID 91235694
N-methyl-N-phenyl-1,2-oxazole-3-carboxamide (PubChem CID 91235694) has the molecular formula C11H10N2O2 and a molecular weight of 202.21 g/mol. Its IUPAC name is N-methyl-N-phenyl-1,2-oxazole-3-carboxamide.
| Compound Name | N-methyl-N-phenyl-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 91235694 |
| Molecular Formula | C11H10N2O2 |
| Molecular Weight | 202.21 g/mol |
| Exact Mass | 202.07 |
| IUPAC Name | N-methyl-N-phenyl-1,2-oxazole-3-carboxamide |
| SMILES | CN(C(=O)c1ccon1)c1ccccc1 |
| InChI | InChI=1S/C11H10N2O2/c1-13(9-5-3-2-4-6-9)11(14)10-7-8-15-12-10/h2-8H,1H3 |
| InChIKey | ZPVXBMARDJJUFA-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.21 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |