C20H18N2O3 — CID 154862775
2-N,5-N-dimethyl-2-N,5-N-diphenylfuran-2,5-dicarboxamide (PubChem CID 154862775) has the molecular formula C20H18N2O3 and a molecular weight of 334.38 g/mol. Its IUPAC name is 2-N,5-N-dimethyl-2-N,5-N-diphenylfuran-2,5-dicarboxamide.
| Compound Name | 2-N,5-N-dimethyl-2-N,5-N-diphenylfuran-2,5-dicarboxamide |
|---|---|
| PubChem CID | 154862775 |
| Molecular Formula | C20H18N2O3 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | 2-N,5-N-dimethyl-2-N,5-N-diphenylfuran-2,5-dicarboxamide |
| SMILES | CN(C(=O)c1ccc(C(=O)N(C)c2ccccc2)o1)c1ccccc1 |
| InChI | InChI=1S/C20H18N2O3/c1-21(15-9-5-3-6-10-15)19(23)17-13-14-18(25-17)20(24)22(2)16-11-7-4-8-12-16/h3-14H,1-2H3 |
| InChIKey | OUWNVYVTPQQSRE-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 53.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |