C13H14N2O2 — CID 110684871
N,2,4-trimethyl-N-phenyl-1,3-oxazole-5-carboxamide (PubChem CID 110684871) has the molecular formula C13H14N2O2 and a molecular weight of 230.27 g/mol. Its IUPAC name is N,2,4-trimethyl-N-phenyl-1,3-oxazole-5-carboxamide.
| Compound Name | N,2,4-trimethyl-N-phenyl-1,3-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 110684871 |
| Molecular Formula | C13H14N2O2 |
| Molecular Weight | 230.27 g/mol |
| Exact Mass | 230.11 |
| IUPAC Name | N,2,4-trimethyl-N-phenyl-1,3-oxazole-5-carboxamide |
| SMILES | Cc1nc(C)c(C(=O)N(C)c2ccccc2)o1 |
| InChI | InChI=1S/C13H14N2O2/c1-9-12(17-10(2)14-9)13(16)15(3)11-7-5-4-6-8-11/h4-8H,1-3H3 |
| InChIKey | CUFWPBJVSWBZLJ-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.27 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |