C12H11ClN2O2 — CID 4140143
N-(2-chlorophenyl)-2,4-dimethyl-1,3-oxazole-5-carboxamide (PubChem CID 4140143) has the molecular formula C12H11ClN2O2 and a molecular weight of 250.69 g/mol. Its IUPAC name is N-(2-chlorophenyl)-2,4-dimethyl-1,3-oxazole-5-carboxamide.
| Compound Name | N-(2-chlorophenyl)-2,4-dimethyl-1,3-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 4140143 |
| Molecular Formula | C12H11ClN2O2 |
| Molecular Weight | 250.69 g/mol |
| Exact Mass | 250.05 |
| IUPAC Name | N-(2-chlorophenyl)-2,4-dimethyl-1,3-oxazole-5-carboxamide |
| SMILES | Cc1nc(C)c(C(=O)Nc2ccccc2Cl)o1 |
| InChI | InChI=1S/C12H11ClN2O2/c1-7-11(17-8(2)14-7)12(16)15-10-6-4-3-5-9(10)13/h3-6H,1-2H3,(H,15,16) |
| InChIKey | HINDISNZYHOSFL-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.69 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |