C16H14N4O2 — CID 71920781
2,4-dimethyl-N-(6-phenylpyridazin-3-yl)-1,3-oxazole-5-carboxamide (PubChem CID 71920781) has the molecular formula C16H14N4O2 and a molecular weight of 294.31 g/mol. Its IUPAC name is 2,4-dimethyl-N-(6-phenylpyridazin-3-yl)-1,3-oxazole-5-carboxamide.
| Compound Name | 2,4-dimethyl-N-(6-phenylpyridazin-3-yl)-1,3-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 71920781 |
| Molecular Formula | C16H14N4O2 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.11 |
| IUPAC Name | 2,4-dimethyl-N-(6-phenylpyridazin-3-yl)-1,3-oxazole-5-carboxamide |
| SMILES | Cc1nc(C)c(C(=O)Nc2ccc(-c3ccccc3)nn2)o1 |
| InChI | InChI=1S/C16H14N4O2/c1-10-15(22-11(2)17-10)16(21)18-14-9-8-13(19-20-14)12-6-4-3-5-7-12/h3-9H,1-2H3,(H,18,20,21) |
| InChIKey | ASFQIKJAUQOKCS-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 80.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |