C13H15N — CID 143178055
2-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-5-methylpyridine (PubChem CID 143178055) has the molecular formula C13H15N and a molecular weight of 185.27 g/mol. Its IUPAC name is 2-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-5-methylpyridine.
| Compound Name | 2-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-5-methylpyridine |
|---|---|
| PubChem CID | 143178055 |
| Molecular Formula | C13H15N |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.12 |
| IUPAC Name | 2-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-5-methylpyridine |
| SMILES | C=C/C=C(\C=C/C)c1ccc(C)cn1 |
| InChI | InChI=1S/C13H15N/c1-4-6-12(7-5-2)13-9-8-11(3)10-14-13/h4-10H,1H2,2-3H3/b7-5-,12-6+ |
| InChIKey | LWHSCKYFGKHRMT-NFWBANDSSA-N |
| XLogP | 3.54 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|