C27H27N3O2 — CID 143000142
N-[5-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-3-[hydroxy(phenyl)methyl]pyrazin-2-yl]-2-(4-methylphenyl)acetamide (PubChem CID 143000142) has the molecular formula C27H27N3O2 and a molecular weight of 425.53 g/mol. Its IUPAC name is N-[5-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-3-[hydroxy(phenyl)methyl]pyrazin-2-yl]-2-(4-methylphenyl)acetamide.
| Compound Name | N-[5-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-3-[hydroxy(phenyl)methyl]pyrazin-2-yl]-2-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 143000142 |
| Molecular Formula | C27H27N3O2 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.21 |
| IUPAC Name | N-[5-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-3-[hydroxy(phenyl)methyl]pyrazin-2-yl]-2-(4-methylphenyl)acetamide |
| SMILES | C=C/C=C(\C=C/C)c1cnc(NC(=O)Cc2ccc(C)cc2)c(C(O)c2ccccc2)n1 |
| InChI | InChI=1S/C27H27N3O2/c1-4-9-21(10-5-2)23-18-28-27(25(29-23)26(32)22-11-7-6-8-12-22)30-24(31)17-20-15-13-19(3)14-16-20/h4-16,18,26,32H,1,17H2,2-3H3,(H,28,30,31)/b10-5-,21-9+ |
| InChIKey | JCNCQFCVIFHPCL-CRPUMRKJSA-N |
| XLogP | 5.19 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|