C23H27N3O — CID 143000025
ethane;N-(3-ethyl-5-phenylpyrazin-2-yl)-2-(4-methylphenyl)acetamide (PubChem CID 143000025) has the molecular formula C23H27N3O and a molecular weight of 361.49 g/mol. Its IUPAC name is ethane;N-(3-ethyl-5-phenylpyrazin-2-yl)-2-(4-methylphenyl)acetamide.
| Compound Name | ethane;N-(3-ethyl-5-phenylpyrazin-2-yl)-2-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 143000025 |
| Molecular Formula | C23H27N3O |
| Molecular Weight | 361.49 g/mol |
| Exact Mass | 361.22 |
| IUPAC Name | ethane;N-(3-ethyl-5-phenylpyrazin-2-yl)-2-(4-methylphenyl)acetamide |
| SMILES | CC.CCc1nc(-c2ccccc2)cnc1NC(=O)Cc1ccc(C)cc1 |
| InChI | InChI=1S/C21H21N3O.C2H6/c1-3-18-21(22-14-19(23-18)17-7-5-4-6-8-17)24-20(25)13-16-11-9-15(2)10-12-16;1-2/h4-12,14H,3,13H2,1-2H3,(H,22,24,25);1-2H3 |
| InChIKey | RKELEIJAVUKXOM-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.49 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |