C28H27BBr3Cl2N3O2 — CID 123158666
N-[3-benzyl-5-(4-methylphenyl)pyrazin-2-yl]-2-(4-methoxyphenyl)acetamide;dichloromethane;tribromoborane (PubChem CID 123158666) has the molecular formula C28H27BBr3Cl2N3O2 and a molecular weight of 758.97 g/mol. Its IUPAC name is N-[3-benzyl-5-(4-methylphenyl)pyrazin-2-yl]-2-(4-methoxyphenyl)acetamide;dichloromethane;tribromoborane.
| Compound Name | N-[3-benzyl-5-(4-methylphenyl)pyrazin-2-yl]-2-(4-methoxyphenyl)acetamide;dichloromethane;tribromoborane |
|---|---|
| PubChem CID | 123158666 |
| Molecular Formula | C28H27BBr3Cl2N3O2 |
| Molecular Weight | 758.97 g/mol |
| Exact Mass | 754.91 |
| IUPAC Name | N-[3-benzyl-5-(4-methylphenyl)pyrazin-2-yl]-2-(4-methoxyphenyl)acetamide;dichloromethane;tribromoborane |
| SMILES | BrB(Br)Br.COc1ccc(CC(=O)Nc2ncc(-c3ccc(C)cc3)nc2Cc2ccccc2)cc1.ClCCl |
| InChI | InChI=1S/C27H25N3O2.CH2Cl2.BBr3/c1-19-8-12-22(13-9-19)25-18-28-27(24(29-25)16-20-6-4-3-5-7-20)30-26(31)17-21-10-14-23(32-2)15-11-21;2-1-3;2-1(3)4/h3-15,18H,16-17H2,1-2H3,(H,28,30,31);1H2; |
| InChIKey | JCXZSJYPMJJXHK-UHFFFAOYSA-N |
| XLogP | 8.81 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 758.97 |
| LogP ≤ 5 | 8.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|