C26H31N3O — CID 101152388
N-[3-benzyl-5-(4-methylphenyl)pyrazin-2-yl]octanamide (PubChem CID 101152388) has the molecular formula C26H31N3O and a molecular weight of 401.55 g/mol. Its IUPAC name is N-[3-benzyl-5-(4-methylphenyl)pyrazin-2-yl]octanamide.
| Compound Name | N-[3-benzyl-5-(4-methylphenyl)pyrazin-2-yl]octanamide |
|---|---|
| PubChem CID | 101152388 |
| Molecular Formula | C26H31N3O |
| Molecular Weight | 401.55 g/mol |
| Exact Mass | 401.25 |
| IUPAC Name | N-[3-benzyl-5-(4-methylphenyl)pyrazin-2-yl]octanamide |
| SMILES | CCCCCCCC(=O)Nc1ncc(-c2ccc(C)cc2)nc1Cc1ccccc1 |
| InChI | InChI=1S/C26H31N3O/c1-3-4-5-6-10-13-25(30)29-26-23(18-21-11-8-7-9-12-21)28-24(19-27-26)22-16-14-20(2)15-17-22/h7-9,11-12,14-17,19H,3-6,10,13,18H2,1-2H3,(H,27,29,30) |
| InChIKey | ZGKVMMMDKAXLOC-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.55 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|