C27H31N3O2 — CID 135364945
ethyl 2-[(3-benzyl-5-phenylpyrazin-2-yl)amino]-3-cyclopentylpropanoate (PubChem CID 135364945) has the molecular formula C27H31N3O2 and a molecular weight of 429.56 g/mol. Its IUPAC name is ethyl 2-[(3-benzyl-5-phenylpyrazin-2-yl)amino]-3-cyclopentylpropanoate.
| Compound Name | ethyl 2-[(3-benzyl-5-phenylpyrazin-2-yl)amino]-3-cyclopentylpropanoate |
|---|---|
| PubChem CID | 135364945 |
| Molecular Formula | C27H31N3O2 |
| Molecular Weight | 429.56 g/mol |
| Exact Mass | 429.24 |
| IUPAC Name | ethyl 2-[(3-benzyl-5-phenylpyrazin-2-yl)amino]-3-cyclopentylpropanoate |
| SMILES | CCOC(=O)C(CC1CCCC1)Nc1ncc(-c2ccccc2)nc1Cc1ccccc1 |
| InChI | InChI=1S/C27H31N3O2/c1-2-32-27(31)24(18-21-13-9-10-14-21)30-26-23(17-20-11-5-3-6-12-20)29-25(19-28-26)22-15-7-4-8-16-22/h3-8,11-12,15-16,19,21,24H,2,9-10,13-14,17-18H2,1H3,(H,28,30) |
| InChIKey | IOCMJUAMMPQTPX-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.56 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |