C33H29N3O3 — CID 135364521
2-[[3-benzyl-5-(4-phenylmethoxyphenyl)pyrazin-2-yl]amino]-3-phenylpropanoic acid (PubChem CID 135364521) has the molecular formula C33H29N3O3 and a molecular weight of 515.61 g/mol. Its IUPAC name is 2-[[3-benzyl-5-(4-phenylmethoxyphenyl)pyrazin-2-yl]amino]-3-phenylpropanoic acid.
| Compound Name | 2-[[3-benzyl-5-(4-phenylmethoxyphenyl)pyrazin-2-yl]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 135364521 |
| Molecular Formula | C33H29N3O3 |
| Molecular Weight | 515.61 g/mol |
| Exact Mass | 515.22 |
| IUPAC Name | 2-[[3-benzyl-5-(4-phenylmethoxyphenyl)pyrazin-2-yl]amino]-3-phenylpropanoic acid |
| SMILES | O=C(O)C(Cc1ccccc1)Nc1ncc(-c2ccc(OCc3ccccc3)cc2)nc1Cc1ccccc1 |
| InChI | InChI=1S/C33H29N3O3/c37-33(38)30(21-25-12-6-2-7-13-25)36-32-29(20-24-10-4-1-5-11-24)35-31(22-34-32)27-16-18-28(19-17-27)39-23-26-14-8-3-9-15-26/h1-19,22,30H,20-21,23H2,(H,34,36)(H,37,38) |
| InChIKey | JPXMKMOGWQTYDH-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 84.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.61 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |