C27H23N3O4 — CID 86604690
(2S)-2-[[5-formyl-6-(4-phenylmethoxyphenyl)pyrimidin-4-yl]amino]-3-phenylpropanoic acid (PubChem CID 86604690) has the molecular formula C27H23N3O4 and a molecular weight of 453.50 g/mol. Its IUPAC name is (2S)-2-[[5-formyl-6-(4-phenylmethoxyphenyl)pyrimidin-4-yl]amino]-3-phenylpropanoic acid.
| Compound Name | (2S)-2-[[5-formyl-6-(4-phenylmethoxyphenyl)pyrimidin-4-yl]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 86604690 |
| Molecular Formula | C27H23N3O4 |
| Molecular Weight | 453.50 g/mol |
| Exact Mass | 453.17 |
| IUPAC Name | (2S)-2-[[5-formyl-6-(4-phenylmethoxyphenyl)pyrimidin-4-yl]amino]-3-phenylpropanoic acid |
| SMILES | O=Cc1c(N[C@@H](Cc2ccccc2)C(=O)O)ncnc1-c1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C27H23N3O4/c31-16-23-25(21-11-13-22(14-12-21)34-17-20-9-5-2-6-10-20)28-18-29-26(23)30-24(27(32)33)15-19-7-3-1-4-8-19/h1-14,16,18,24H,15,17H2,(H,32,33)(H,28,29,30)/t24-/m0/s1 |
| InChIKey | CDQIVJBRYNHSNJ-DEOSSOPVSA-N |
| XLogP | 4.64 |
| TPSA | 101.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.50 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|