C26H22FN3O3 — CID 58629333
2-[[6-[4-[(2-fluorophenyl)methoxy]phenyl]pyrimidin-4-yl]amino]-3-phenylpropanoic acid (PubChem CID 58629333) has the molecular formula C26H22FN3O3 and a molecular weight of 443.48 g/mol. Its IUPAC name is 2-[[6-[4-[(2-fluorophenyl)methoxy]phenyl]pyrimidin-4-yl]amino]-3-phenylpropanoic acid.
| Compound Name | 2-[[6-[4-[(2-fluorophenyl)methoxy]phenyl]pyrimidin-4-yl]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 58629333 |
| Molecular Formula | C26H22FN3O3 |
| Molecular Weight | 443.48 g/mol |
| Exact Mass | 443.16 |
| IUPAC Name | 2-[[6-[4-[(2-fluorophenyl)methoxy]phenyl]pyrimidin-4-yl]amino]-3-phenylpropanoic acid |
| SMILES | O=C(O)C(Cc1ccccc1)Nc1cc(-c2ccc(OCc3ccccc3F)cc2)ncn1 |
| InChI | InChI=1S/C26H22FN3O3/c27-22-9-5-4-8-20(22)16-33-21-12-10-19(11-13-21)23-15-25(29-17-28-23)30-24(26(31)32)14-18-6-2-1-3-7-18/h1-13,15,17,24H,14,16H2,(H,31,32)(H,28,29,30) |
| InChIKey | WCLXNNJSMFBVDT-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 84.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.48 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |