C28H28N4O3 — CID 141092456
ethyl (2S)-3-(4-aminophenyl)-2-[[6-(4-phenylmethoxyphenyl)pyrimidin-4-yl]amino]propanoate (PubChem CID 141092456) has the molecular formula C28H28N4O3 and a molecular weight of 468.56 g/mol. Its IUPAC name is ethyl (2S)-3-(4-aminophenyl)-2-[[6-(4-phenylmethoxyphenyl)pyrimidin-4-yl]amino]propanoate.
| Compound Name | ethyl (2S)-3-(4-aminophenyl)-2-[[6-(4-phenylmethoxyphenyl)pyrimidin-4-yl]amino]propanoate |
|---|---|
| PubChem CID | 141092456 |
| Molecular Formula | C28H28N4O3 |
| Molecular Weight | 468.56 g/mol |
| Exact Mass | 468.22 |
| IUPAC Name | ethyl (2S)-3-(4-aminophenyl)-2-[[6-(4-phenylmethoxyphenyl)pyrimidin-4-yl]amino]propanoate |
| SMILES | CCOC(=O)[C@H](Cc1ccc(N)cc1)Nc1cc(-c2ccc(OCc3ccccc3)cc2)ncn1 |
| InChI | InChI=1S/C28H28N4O3/c1-2-34-28(33)26(16-20-8-12-23(29)13-9-20)32-27-17-25(30-19-31-27)22-10-14-24(15-11-22)35-18-21-6-4-3-5-7-21/h3-15,17,19,26H,2,16,18,29H2,1H3,(H,30,31,32)/t26-/m0/s1 |
| InChIKey | XDQUWHZBMRWSEV-SANMLTNESA-N |
| XLogP | 4.89 |
| TPSA | 99.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.56 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|