C21H19N3O3 — CID 86604686
methyl (2S)-2-[[6-(4-formylphenyl)pyrimidin-4-yl]amino]-3-phenylpropanoate (PubChem CID 86604686) has the molecular formula C21H19N3O3 and a molecular weight of 361.40 g/mol. Its IUPAC name is methyl (2S)-2-[[6-(4-formylphenyl)pyrimidin-4-yl]amino]-3-phenylpropanoate.
| Compound Name | methyl (2S)-2-[[6-(4-formylphenyl)pyrimidin-4-yl]amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 86604686 |
| Molecular Formula | C21H19N3O3 |
| Molecular Weight | 361.40 g/mol |
| Exact Mass | 361.14 |
| IUPAC Name | methyl (2S)-2-[[6-(4-formylphenyl)pyrimidin-4-yl]amino]-3-phenylpropanoate |
| SMILES | COC(=O)[C@H](Cc1ccccc1)Nc1cc(-c2ccc(C=O)cc2)ncn1 |
| InChI | InChI=1S/C21H19N3O3/c1-27-21(26)19(11-15-5-3-2-4-6-15)24-20-12-18(22-14-23-20)17-9-7-16(13-25)8-10-17/h2-10,12-14,19H,11H2,1H3,(H,22,23,24)/t19-/m0/s1 |
| InChIKey | IHGALHLNIGQJDZ-IBGZPJMESA-N |
| XLogP | 3.15 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.40 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|