C34H41N3O2 — CID 142893965
(Z)-but-2-ene;ethane;methyl 3-phenyl-2-[[6-[4-(2-phenylethyl)phenyl]pyrimidin-4-yl]amino]propanoate (PubChem CID 142893965) has the molecular formula C34H41N3O2 and a molecular weight of 523.72 g/mol. Its IUPAC name is (Z)-but-2-ene;ethane;methyl 3-phenyl-2-[[6-[4-(2-phenylethyl)phenyl]pyrimidin-4-yl]amino]propanoate.
| Compound Name | (Z)-but-2-ene;ethane;methyl 3-phenyl-2-[[6-[4-(2-phenylethyl)phenyl]pyrimidin-4-yl]amino]propanoate |
|---|---|
| PubChem CID | 142893965 |
| Molecular Formula | C34H41N3O2 |
| Molecular Weight | 523.72 g/mol |
| Exact Mass | 523.32 |
| IUPAC Name | (Z)-but-2-ene;ethane;methyl 3-phenyl-2-[[6-[4-(2-phenylethyl)phenyl]pyrimidin-4-yl]amino]propanoate |
| SMILES | C/C=C\C.CC.COC(=O)C(Cc1ccccc1)Nc1cc(-c2ccc(CCc3ccccc3)cc2)ncn1 |
| InChI | InChI=1S/C28H27N3O2.C4H8.C2H6/c1-33-28(32)26(18-23-10-6-3-7-11-23)31-27-19-25(29-20-30-27)24-16-14-22(15-17-24)13-12-21-8-4-2-5-9-21;1-3-4-2;1-2/h2-11,14-17,19-20,26H,12-13,18H2,1H3,(H,29,30,31);3-4H,1-2H3;1-2H3/b;4-3-; |
| InChIKey | PEMMOTJECOHDSN-LWFKIUJUSA-N |
| XLogP | 7.73 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.72 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|