C48H43N7O6 — CID 172934640
methyl 2-[[6-(4-formylphenyl)pyrimidin-4-yl]amino]-3-phenylpropanoate;methyl 2-[[6-[4-[(E)-phenoxyiminomethyl]phenyl]pyrimidin-4-yl]amino]-3-phenylpropanoate (PubChem CID 172934640) has the molecular formula C48H43N7O6 and a molecular weight of 813.92 g/mol. Its IUPAC name is methyl 2-[[6-(4-formylphenyl)pyrimidin-4-yl]amino]-3-phenylpropanoate;methyl 2-[[6-[4-[(E)-phenoxyiminomethyl]phenyl]pyrimidin-4-yl]amino]-3-phenylpropanoate.
| Compound Name | methyl 2-[[6-(4-formylphenyl)pyrimidin-4-yl]amino]-3-phenylpropanoate;methyl 2-[[6-[4-[(E)-phenoxyiminomethyl]phenyl]pyrimidin-4-yl]amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 172934640 |
| Molecular Formula | C48H43N7O6 |
| Molecular Weight | 813.92 g/mol |
| Exact Mass | 813.33 |
| IUPAC Name | methyl 2-[[6-(4-formylphenyl)pyrimidin-4-yl]amino]-3-phenylpropanoate;methyl 2-[[6-[4-[(E)-phenoxyiminomethyl]phenyl]pyrimidin-4-yl]amino]-3-phenylpropanoate |
| SMILES | COC(=O)C(Cc1ccccc1)Nc1cc(-c2ccc(/C=N/Oc3ccccc3)cc2)ncn1.COC(=O)C(Cc1ccccc1)Nc1cc(-c2ccc(C=O)cc2)ncn1 |
| InChI | InChI=1S/C27H24N4O3.C21H19N3O3/c1-33-27(32)25(16-20-8-4-2-5-9-20)31-26-17-24(28-19-29-26)22-14-12-21(13-15-22)18-30-34-23-10-6-3-7-11-23;1-27-21(26)19(11-15-5-3-2-4-6-15)24-20-12-18(22-14-23-20)17-9-7-16(13-25)8-10-17/h2-15,17-19,25H,16H2,1H3,(H,28,29,31);2-10,12-14,19H,11H2,1H3,(H,22,23,24)/b30-18+; |
| InChIKey | FRQUZPHRGAHDIK-APPLVYIASA-N |
| XLogP | 7.91 |
| TPSA | 166.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 61 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 813.92 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|