C27H21N3O2 — CID 58629225
3-phenyl-2-[[6-[4-(2-phenylethynyl)phenyl]pyrimidin-4-yl]amino]propanoic acid (PubChem CID 58629225) has the molecular formula C27H21N3O2 and a molecular weight of 419.48 g/mol. Its IUPAC name is 3-phenyl-2-[[6-[4-(2-phenylethynyl)phenyl]pyrimidin-4-yl]amino]propanoic acid.
| Compound Name | 3-phenyl-2-[[6-[4-(2-phenylethynyl)phenyl]pyrimidin-4-yl]amino]propanoic acid |
|---|---|
| PubChem CID | 58629225 |
| Molecular Formula | C27H21N3O2 |
| Molecular Weight | 419.48 g/mol |
| Exact Mass | 419.16 |
| IUPAC Name | 3-phenyl-2-[[6-[4-(2-phenylethynyl)phenyl]pyrimidin-4-yl]amino]propanoic acid |
| SMILES | O=C(O)C(Cc1ccccc1)Nc1cc(-c2ccc(C#Cc3ccccc3)cc2)ncn1 |
| InChI | InChI=1S/C27H21N3O2/c31-27(32)25(17-22-9-5-2-6-10-22)30-26-18-24(28-19-29-26)23-15-13-21(14-16-23)12-11-20-7-3-1-4-8-20/h1-10,13-16,18-19,25H,17H2,(H,31,32)(H,28,29,30) |
| InChIKey | CBGSRTIDTAZXIT-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.48 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|