C24H27N3O3 — CID 142893994
2-[[6-(4-phenylmethoxyphenyl)pyrimidin-4-yl]amino]heptanoic acid (PubChem CID 142893994) has the molecular formula C24H27N3O3 and a molecular weight of 405.50 g/mol. Its IUPAC name is 2-[[6-(4-phenylmethoxyphenyl)pyrimidin-4-yl]amino]heptanoic acid.
| Compound Name | 2-[[6-(4-phenylmethoxyphenyl)pyrimidin-4-yl]amino]heptanoic acid |
|---|---|
| PubChem CID | 142893994 |
| Molecular Formula | C24H27N3O3 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.21 |
| IUPAC Name | 2-[[6-(4-phenylmethoxyphenyl)pyrimidin-4-yl]amino]heptanoic acid |
| SMILES | CCCCCC(Nc1cc(-c2ccc(OCc3ccccc3)cc2)ncn1)C(=O)O |
| InChI | InChI=1S/C24H27N3O3/c1-2-3-5-10-21(24(28)29)27-23-15-22(25-17-26-23)19-11-13-20(14-12-19)30-16-18-8-6-4-7-9-18/h4,6-9,11-15,17,21H,2-3,5,10,16H2,1H3,(H,28,29)(H,25,26,27) |
| InChIKey | FRKNJLVVLCMFNJ-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 84.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|