C20H25N3O3 — CID 58629153
2-[[6-[4-(cyclopropylmethoxy)phenyl]pyrimidin-4-yl]amino]hexanoic acid (PubChem CID 58629153) has the molecular formula C20H25N3O3 and a molecular weight of 355.44 g/mol. Its IUPAC name is 2-[[6-[4-(cyclopropylmethoxy)phenyl]pyrimidin-4-yl]amino]hexanoic acid.
| Compound Name | 2-[[6-[4-(cyclopropylmethoxy)phenyl]pyrimidin-4-yl]amino]hexanoic acid |
|---|---|
| PubChem CID | 58629153 |
| Molecular Formula | C20H25N3O3 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | 2-[[6-[4-(cyclopropylmethoxy)phenyl]pyrimidin-4-yl]amino]hexanoic acid |
| SMILES | CCCCC(Nc1cc(-c2ccc(OCC3CC3)cc2)ncn1)C(=O)O |
| InChI | InChI=1S/C20H25N3O3/c1-2-3-4-17(20(24)25)23-19-11-18(21-13-22-19)15-7-9-16(10-8-15)26-12-14-5-6-14/h7-11,13-14,17H,2-6,12H2,1H3,(H,24,25)(H,21,22,23) |
| InChIKey | MJFSZIGRSLLIAD-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 84.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |