C35H33N3O3 — CID 142461565
ethyl (2S)-2-[[3-benzyl-5-(4-phenylmethoxyphenyl)pyrazin-2-yl]amino]-3-phenylpropanoate (PubChem CID 142461565) has the molecular formula C35H33N3O3 and a molecular weight of 543.67 g/mol. Its IUPAC name is ethyl (2S)-2-[[3-benzyl-5-(4-phenylmethoxyphenyl)pyrazin-2-yl]amino]-3-phenylpropanoate.
| Compound Name | ethyl (2S)-2-[[3-benzyl-5-(4-phenylmethoxyphenyl)pyrazin-2-yl]amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 142461565 |
| Molecular Formula | C35H33N3O3 |
| Molecular Weight | 543.67 g/mol |
| Exact Mass | 543.25 |
| IUPAC Name | ethyl (2S)-2-[[3-benzyl-5-(4-phenylmethoxyphenyl)pyrazin-2-yl]amino]-3-phenylpropanoate |
| SMILES | CCOC(=O)[C@H](Cc1ccccc1)Nc1ncc(-c2ccc(OCc3ccccc3)cc2)nc1Cc1ccccc1 |
| InChI | InChI=1S/C35H33N3O3/c1-2-40-35(39)32(23-27-14-8-4-9-15-27)38-34-31(22-26-12-6-3-7-13-26)37-33(24-36-34)29-18-20-30(21-19-29)41-25-28-16-10-5-11-17-28/h3-21,24,32H,2,22-23,25H2,1H3,(H,36,38)/t32-/m0/s1 |
| InChIKey | PYZYENHJKWANPK-YTTGMZPUSA-N |
| XLogP | 6.90 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.67 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |