C28H28FN3O3 — CID 135364617
ethyl 2-[[3-benzyl-5-(2-fluorophenyl)pyrazin-2-yl]amino]-3-(5-ethylfuran-2-yl)propanoate (PubChem CID 135364617) has the molecular formula C28H28FN3O3 and a molecular weight of 473.55 g/mol. Its IUPAC name is ethyl 2-[[3-benzyl-5-(2-fluorophenyl)pyrazin-2-yl]amino]-3-(5-ethylfuran-2-yl)propanoate.
| Compound Name | ethyl 2-[[3-benzyl-5-(2-fluorophenyl)pyrazin-2-yl]amino]-3-(5-ethylfuran-2-yl)propanoate |
|---|---|
| PubChem CID | 135364617 |
| Molecular Formula | C28H28FN3O3 |
| Molecular Weight | 473.55 g/mol |
| Exact Mass | 473.21 |
| IUPAC Name | ethyl 2-[[3-benzyl-5-(2-fluorophenyl)pyrazin-2-yl]amino]-3-(5-ethylfuran-2-yl)propanoate |
| SMILES | CCOC(=O)C(Cc1ccc(CC)o1)Nc1ncc(-c2ccccc2F)nc1Cc1ccccc1 |
| InChI | InChI=1S/C28H28FN3O3/c1-3-20-14-15-21(35-20)17-25(28(33)34-4-2)32-27-24(16-19-10-6-5-7-11-19)31-26(18-30-27)22-12-8-9-13-23(22)29/h5-15,18,25H,3-4,16-17H2,1-2H3,(H,30,32) |
| InChIKey | XFTNZYRSQXRMHO-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.55 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |