C25H20F3N3O3 — CID 135364642
2-[(3-benzyl-5-phenylpyrazin-2-yl)amino]-3-[5-(trifluoromethyl)furan-2-yl]propanoic acid (PubChem CID 135364642) has the molecular formula C25H20F3N3O3 and a molecular weight of 467.45 g/mol. Its IUPAC name is 2-[(3-benzyl-5-phenylpyrazin-2-yl)amino]-3-[5-(trifluoromethyl)furan-2-yl]propanoic acid.
| Compound Name | 2-[(3-benzyl-5-phenylpyrazin-2-yl)amino]-3-[5-(trifluoromethyl)furan-2-yl]propanoic acid |
|---|---|
| PubChem CID | 135364642 |
| Molecular Formula | C25H20F3N3O3 |
| Molecular Weight | 467.45 g/mol |
| Exact Mass | 467.15 |
| IUPAC Name | 2-[(3-benzyl-5-phenylpyrazin-2-yl)amino]-3-[5-(trifluoromethyl)furan-2-yl]propanoic acid |
| SMILES | O=C(O)C(Cc1ccc(C(F)(F)F)o1)Nc1ncc(-c2ccccc2)nc1Cc1ccccc1 |
| InChI | InChI=1S/C25H20F3N3O3/c26-25(27,28)22-12-11-18(34-22)14-20(24(32)33)31-23-19(13-16-7-3-1-4-8-16)30-21(15-29-23)17-9-5-2-6-10-17/h1-12,15,20H,13-14H2,(H,29,31)(H,32,33) |
| InChIKey | BEWPVDROXBRNDB-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 88.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.45 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |