C28H24FNO3 — CID 58629332
2-[3-[4-[(2-fluorophenyl)methoxy]phenyl]anilino]-3-phenylpropanoic acid (PubChem CID 58629332) has the molecular formula C28H24FNO3 and a molecular weight of 441.50 g/mol. Its IUPAC name is 2-[3-[4-[(2-fluorophenyl)methoxy]phenyl]anilino]-3-phenylpropanoic acid.
| Compound Name | 2-[3-[4-[(2-fluorophenyl)methoxy]phenyl]anilino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 58629332 |
| Molecular Formula | C28H24FNO3 |
| Molecular Weight | 441.50 g/mol |
| Exact Mass | 441.17 |
| IUPAC Name | 2-[3-[4-[(2-fluorophenyl)methoxy]phenyl]anilino]-3-phenylpropanoic acid |
| SMILES | O=C(O)C(Cc1ccccc1)Nc1cccc(-c2ccc(OCc3ccccc3F)cc2)c1 |
| InChI | InChI=1S/C28H24FNO3/c29-26-12-5-4-9-23(26)19-33-25-15-13-21(14-16-25)22-10-6-11-24(18-22)30-27(28(31)32)17-20-7-2-1-3-8-20/h1-16,18,27,30H,17,19H2,(H,31,32) |
| InChIKey | RIZABSCKIGTJSV-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.50 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |