C30H28N2O3 — CID 141088901
(2S)-2-anilino-3-[4-[3-[(phenacylamino)methyl]phenyl]phenyl]propanoic acid (PubChem CID 141088901) has the molecular formula C30H28N2O3 and a molecular weight of 464.57 g/mol. Its IUPAC name is (2S)-2-anilino-3-[4-[3-[(phenacylamino)methyl]phenyl]phenyl]propanoic acid.
| Compound Name | (2S)-2-anilino-3-[4-[3-[(phenacylamino)methyl]phenyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 141088901 |
| Molecular Formula | C30H28N2O3 |
| Molecular Weight | 464.57 g/mol |
| Exact Mass | 464.21 |
| IUPAC Name | (2S)-2-anilino-3-[4-[3-[(phenacylamino)methyl]phenyl]phenyl]propanoic acid |
| SMILES | O=C(CNCc1cccc(-c2ccc(C[C@H](Nc3ccccc3)C(=O)O)cc2)c1)c1ccccc1 |
| InChI | InChI=1S/C30H28N2O3/c33-29(25-9-3-1-4-10-25)21-31-20-23-8-7-11-26(18-23)24-16-14-22(15-17-24)19-28(30(34)35)32-27-12-5-2-6-13-27/h1-18,28,31-32H,19-21H2,(H,34,35)/t28-/m0/s1 |
| InChIKey | ZLWUBFTXQYJCFC-NDEPHWFRSA-N |
| XLogP | 5.43 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.57 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |