C29H25NO5S — CID 58717714
(2S)-2-[[3-(4-methylsulfonylphenyl)benzoyl]amino]-3-(4-phenylphenyl)propanoic acid (PubChem CID 58717714) has the molecular formula C29H25NO5S and a molecular weight of 499.59 g/mol. Its IUPAC name is (2S)-2-[[3-(4-methylsulfonylphenyl)benzoyl]amino]-3-(4-phenylphenyl)propanoic acid.
| Compound Name | (2S)-2-[[3-(4-methylsulfonylphenyl)benzoyl]amino]-3-(4-phenylphenyl)propanoic acid |
|---|---|
| PubChem CID | 58717714 |
| Molecular Formula | C29H25NO5S |
| Molecular Weight | 499.59 g/mol |
| Exact Mass | 499.15 |
| IUPAC Name | (2S)-2-[[3-(4-methylsulfonylphenyl)benzoyl]amino]-3-(4-phenylphenyl)propanoic acid |
| SMILES | CS(=O)(=O)c1ccc(-c2cccc(C(=O)N[C@@H](Cc3ccc(-c4ccccc4)cc3)C(=O)O)c2)cc1 |
| InChI | InChI=1S/C29H25NO5S/c1-36(34,35)26-16-14-23(15-17-26)24-8-5-9-25(19-24)28(31)30-27(29(32)33)18-20-10-12-22(13-11-20)21-6-3-2-4-7-21/h2-17,19,27H,18H2,1H3,(H,30,31)(H,32,33)/t27-/m0/s1 |
| InChIKey | PYQWKXXIMRPPIF-MHZLTWQESA-N |
| XLogP | 4.85 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.59 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |