C29H23F2NO4 — CID 54768351
3-[6-[(2-fluorophenyl)methoxy]naphthalen-2-yl]-2-[[(E)-3-(4-fluorophenyl)prop-2-enoyl]amino]propanoic acid (PubChem CID 54768351) has the molecular formula C29H23F2NO4 and a molecular weight of 487.50 g/mol. Its IUPAC name is 3-[6-[(2-fluorophenyl)methoxy]naphthalen-2-yl]-2-[[(E)-3-(4-fluorophenyl)prop-2-enoyl]amino]propanoic acid.
| Compound Name | 3-[6-[(2-fluorophenyl)methoxy]naphthalen-2-yl]-2-[[(E)-3-(4-fluorophenyl)prop-2-enoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 54768351 |
| Molecular Formula | C29H23F2NO4 |
| Molecular Weight | 487.50 g/mol |
| Exact Mass | 487.16 |
| IUPAC Name | 3-[6-[(2-fluorophenyl)methoxy]naphthalen-2-yl]-2-[[(E)-3-(4-fluorophenyl)prop-2-enoyl]amino]propanoic acid |
| SMILES | O=C(/C=C/c1ccc(F)cc1)NC(Cc1ccc2cc(OCc3ccccc3F)ccc2c1)C(=O)O |
| InChI | InChI=1S/C29H23F2NO4/c30-24-11-6-19(7-12-24)8-14-28(33)32-27(29(34)35)16-20-5-9-22-17-25(13-10-21(22)15-20)36-18-23-3-1-2-4-26(23)31/h1-15,17,27H,16,18H2,(H,32,33)(H,34,35)/b14-8+ |
| InChIKey | PKWDAQOUGNOSIH-RIYZIHGNSA-N |
| XLogP | 5.52 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.50 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|