C29H22Cl2FNO4 — CID 54768353
2-[[(E)-3-(2,4-dichlorophenyl)prop-2-enoyl]amino]-3-[6-[(2-fluorophenyl)methoxy]naphthalen-2-yl]propanoic acid (PubChem CID 54768353) has the molecular formula C29H22Cl2FNO4 and a molecular weight of 538.40 g/mol. Its IUPAC name is 2-[[(E)-3-(2,4-dichlorophenyl)prop-2-enoyl]amino]-3-[6-[(2-fluorophenyl)methoxy]naphthalen-2-yl]propanoic acid.
| Compound Name | 2-[[(E)-3-(2,4-dichlorophenyl)prop-2-enoyl]amino]-3-[6-[(2-fluorophenyl)methoxy]naphthalen-2-yl]propanoic acid |
|---|---|
| PubChem CID | 54768353 |
| Molecular Formula | C29H22Cl2FNO4 |
| Molecular Weight | 538.40 g/mol |
| Exact Mass | 537.09 |
| IUPAC Name | 2-[[(E)-3-(2,4-dichlorophenyl)prop-2-enoyl]amino]-3-[6-[(2-fluorophenyl)methoxy]naphthalen-2-yl]propanoic acid |
| SMILES | O=C(/C=C/c1ccc(Cl)cc1Cl)NC(Cc1ccc2cc(OCc3ccccc3F)ccc2c1)C(=O)O |
| InChI | InChI=1S/C29H22Cl2FNO4/c30-23-10-7-19(25(31)16-23)9-12-28(34)33-27(29(35)36)14-18-5-6-21-15-24(11-8-20(21)13-18)37-17-22-3-1-2-4-26(22)32/h1-13,15-16,27H,14,17H2,(H,33,34)(H,35,36)/b12-9+ |
| InChIKey | LOKQCBKLWIHJHQ-FMIVXFBMSA-N |
| XLogP | 6.69 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.40 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|