C20H19NO7 — CID 146540368
(2S)-2-[[(E)-3-(2-hydroxy-4-phenylmethoxyphenyl)prop-2-enoyl]amino]butanedioic acid (PubChem CID 146540368) has the molecular formula C20H19NO7 and a molecular weight of 385.37 g/mol. Its IUPAC name is (2S)-2-[[(E)-3-(2-hydroxy-4-phenylmethoxyphenyl)prop-2-enoyl]amino]butanedioic acid.
| Compound Name | (2S)-2-[[(E)-3-(2-hydroxy-4-phenylmethoxyphenyl)prop-2-enoyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 146540368 |
| Molecular Formula | C20H19NO7 |
| Molecular Weight | 385.37 g/mol |
| Exact Mass | 385.12 |
| IUPAC Name | (2S)-2-[[(E)-3-(2-hydroxy-4-phenylmethoxyphenyl)prop-2-enoyl]amino]butanedioic acid |
| SMILES | O=C(O)C[C@H](NC(=O)/C=C/c1ccc(OCc2ccccc2)cc1O)C(=O)O |
| InChI | InChI=1S/C20H19NO7/c22-17-10-15(28-12-13-4-2-1-3-5-13)8-6-14(17)7-9-18(23)21-16(20(26)27)11-19(24)25/h1-10,16,22H,11-12H2,(H,21,23)(H,24,25)(H,26,27)/b9-7+/t16-/m0/s1 |
| InChIKey | NLJMVPNXHYJGQF-DYLHUKMJSA-N |
| XLogP | 2.03 |
| TPSA | 133.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.37 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|