C19H17F2NO4 — CID 86655515
(2S)-2-[3-(2,4-difluorophenyl)prop-2-enoylamino]-3-(4-methoxyphenyl)propanoic acid (PubChem CID 86655515) has the molecular formula C19H17F2NO4 and a molecular weight of 361.34 g/mol. Its IUPAC name is (2S)-2-[3-(2,4-difluorophenyl)prop-2-enoylamino]-3-(4-methoxyphenyl)propanoic acid.
| Compound Name | (2S)-2-[3-(2,4-difluorophenyl)prop-2-enoylamino]-3-(4-methoxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 86655515 |
| Molecular Formula | C19H17F2NO4 |
| Molecular Weight | 361.34 g/mol |
| Exact Mass | 361.11 |
| IUPAC Name | (2S)-2-[3-(2,4-difluorophenyl)prop-2-enoylamino]-3-(4-methoxyphenyl)propanoic acid |
| SMILES | COc1ccc(C[C@H](NC(=O)C=Cc2ccc(F)cc2F)C(=O)O)cc1 |
| InChI | InChI=1S/C19H17F2NO4/c1-26-15-7-2-12(3-8-15)10-17(19(24)25)22-18(23)9-5-13-4-6-14(20)11-16(13)21/h2-9,11,17H,10H2,1H3,(H,22,23)(H,24,25)/t17-/m0/s1 |
| InChIKey | YKSJXSFJMSOPPL-KRWDZBQOSA-N |
| XLogP | 2.80 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.34 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|