C21H23NO4 — CID 53264038
3-phenyl-2-[[(E)-3-(2-propoxyphenyl)prop-2-enoyl]amino]propanoic acid (PubChem CID 53264038) has the molecular formula C21H23NO4 and a molecular weight of 353.42 g/mol. Its IUPAC name is 3-phenyl-2-[[(E)-3-(2-propoxyphenyl)prop-2-enoyl]amino]propanoic acid.
| Compound Name | 3-phenyl-2-[[(E)-3-(2-propoxyphenyl)prop-2-enoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 53264038 |
| Molecular Formula | C21H23NO4 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | 3-phenyl-2-[[(E)-3-(2-propoxyphenyl)prop-2-enoyl]amino]propanoic acid |
| SMILES | CCCOc1ccccc1/C=C/C(=O)NC(Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C21H23NO4/c1-2-14-26-19-11-7-6-10-17(19)12-13-20(23)22-18(21(24)25)15-16-8-4-3-5-9-16/h3-13,18H,2,14-15H2,1H3,(H,22,23)(H,24,25)/b13-12+ |
| InChIKey | WWWSENWUXPWKBH-OUKQBFOZSA-N |
| XLogP | 3.30 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|