C25H15F6N3O — CID 123596741
N-[3-benzyl-5-(4-fluorophenyl)pyrazin-2-yl]-2-(2,3,4,5,6-pentafluorophenyl)acetamide (PubChem CID 123596741) has the molecular formula C25H15F6N3O and a molecular weight of 487.40 g/mol. Its IUPAC name is N-[3-benzyl-5-(4-fluorophenyl)pyrazin-2-yl]-2-(2,3,4,5,6-pentafluorophenyl)acetamide.
| Compound Name | N-[3-benzyl-5-(4-fluorophenyl)pyrazin-2-yl]-2-(2,3,4,5,6-pentafluorophenyl)acetamide |
|---|---|
| PubChem CID | 123596741 |
| Molecular Formula | C25H15F6N3O |
| Molecular Weight | 487.40 g/mol |
| Exact Mass | 487.11 |
| IUPAC Name | N-[3-benzyl-5-(4-fluorophenyl)pyrazin-2-yl]-2-(2,3,4,5,6-pentafluorophenyl)acetamide |
| SMILES | O=C(Cc1c(F)c(F)c(F)c(F)c1F)Nc1ncc(-c2ccc(F)cc2)nc1Cc1ccccc1 |
| InChI | InChI=1S/C25H15F6N3O/c26-15-8-6-14(7-9-15)18-12-32-25(17(33-18)10-13-4-2-1-3-5-13)34-19(35)11-16-20(27)22(29)24(31)23(30)21(16)28/h1-9,12H,10-11H2,(H,32,34,35) |
| InChIKey | KNYGASRBIWDOAP-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.40 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|