C25H22F5N3O2 — CID 137035124
N-[3-(cyclohexylmethyl)-5-(4-hydroxyphenyl)pyrazin-2-yl]-2-(2,3,4,5,6-pentafluorophenyl)acetamide (PubChem CID 137035124) has the molecular formula C25H22F5N3O2 and a molecular weight of 491.46 g/mol. Its IUPAC name is N-[3-(cyclohexylmethyl)-5-(4-hydroxyphenyl)pyrazin-2-yl]-2-(2,3,4,5,6-pentafluorophenyl)acetamide.
| Compound Name | N-[3-(cyclohexylmethyl)-5-(4-hydroxyphenyl)pyrazin-2-yl]-2-(2,3,4,5,6-pentafluorophenyl)acetamide |
|---|---|
| PubChem CID | 137035124 |
| Molecular Formula | C25H22F5N3O2 |
| Molecular Weight | 491.46 g/mol |
| Exact Mass | 491.16 |
| IUPAC Name | N-[3-(cyclohexylmethyl)-5-(4-hydroxyphenyl)pyrazin-2-yl]-2-(2,3,4,5,6-pentafluorophenyl)acetamide |
| SMILES | O=C(Cc1c(F)c(F)c(F)c(F)c1F)Nc1ncc(-c2ccc(O)cc2)nc1CC1CCCCC1 |
| InChI | InChI=1S/C25H22F5N3O2/c26-20-16(21(27)23(29)24(30)22(20)28)11-19(35)33-25-17(10-13-4-2-1-3-5-13)32-18(12-31-25)14-6-8-15(34)9-7-14/h6-9,12-13,34H,1-5,10-11H2,(H,31,33,35) |
| InChIKey | TUNMIXDFFZMZAJ-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.46 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|