C28H27N3O2 — CID 136624996
N-[3-(cyclopentylmethyl)-5-(4-hydroxyphenyl)pyrazin-2-yl]-2-naphthalen-2-ylacetamide (PubChem CID 136624996) has the molecular formula C28H27N3O2 and a molecular weight of 437.54 g/mol. Its IUPAC name is N-[3-(cyclopentylmethyl)-5-(4-hydroxyphenyl)pyrazin-2-yl]-2-naphthalen-2-ylacetamide.
| Compound Name | N-[3-(cyclopentylmethyl)-5-(4-hydroxyphenyl)pyrazin-2-yl]-2-naphthalen-2-ylacetamide |
|---|---|
| PubChem CID | 136624996 |
| Molecular Formula | C28H27N3O2 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.21 |
| IUPAC Name | N-[3-(cyclopentylmethyl)-5-(4-hydroxyphenyl)pyrazin-2-yl]-2-naphthalen-2-ylacetamide |
| SMILES | O=C(Cc1ccc2ccccc2c1)Nc1ncc(-c2ccc(O)cc2)nc1CC1CCCC1 |
| InChI | InChI=1S/C28H27N3O2/c32-24-13-11-22(12-14-24)26-18-29-28(25(30-26)16-19-5-1-2-6-19)31-27(33)17-20-9-10-21-7-3-4-8-23(21)15-20/h3-4,7-15,18-19,32H,1-2,5-6,16-17H2,(H,29,31,33) |
| InChIKey | ZNUAGJXWFNXXJH-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |