C28H31N3O3 — CID 88905243
N-[3-(cyclopentylmethyl)-5-[4-(1-hydroxyethyl)phenyl]pyrazin-2-yl]-2-[4-(oxiran-2-yl)phenyl]acetamide (PubChem CID 88905243) has the molecular formula C28H31N3O3 and a molecular weight of 457.57 g/mol. Its IUPAC name is N-[3-(cyclopentylmethyl)-5-[4-(1-hydroxyethyl)phenyl]pyrazin-2-yl]-2-[4-(oxiran-2-yl)phenyl]acetamide.
| Compound Name | N-[3-(cyclopentylmethyl)-5-[4-(1-hydroxyethyl)phenyl]pyrazin-2-yl]-2-[4-(oxiran-2-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 88905243 |
| Molecular Formula | C28H31N3O3 |
| Molecular Weight | 457.57 g/mol |
| Exact Mass | 457.24 |
| IUPAC Name | N-[3-(cyclopentylmethyl)-5-[4-(1-hydroxyethyl)phenyl]pyrazin-2-yl]-2-[4-(oxiran-2-yl)phenyl]acetamide |
| SMILES | CC(O)c1ccc(-c2cnc(NC(=O)Cc3ccc(C4CO4)cc3)c(CC3CCCC3)n2)cc1 |
| InChI | InChI=1S/C28H31N3O3/c1-18(32)21-10-12-22(13-11-21)25-16-29-28(24(30-25)14-19-4-2-3-5-19)31-27(33)15-20-6-8-23(9-7-20)26-17-34-26/h6-13,16,18-19,26,32H,2-5,14-15,17H2,1H3,(H,29,31,33) |
| InChIKey | YTKACJSVVUPMJR-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 87.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.57 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|