C24H33N3O2 — CID 123781945
N-[3-(2-cyclohexylethyl)-5-[4-(hydroxymethyl)phenyl]pyrazin-2-yl]-3-methylbutanamide (PubChem CID 123781945) has the molecular formula C24H33N3O2 and a molecular weight of 395.55 g/mol. Its IUPAC name is N-[3-(2-cyclohexylethyl)-5-[4-(hydroxymethyl)phenyl]pyrazin-2-yl]-3-methylbutanamide.
| Compound Name | N-[3-(2-cyclohexylethyl)-5-[4-(hydroxymethyl)phenyl]pyrazin-2-yl]-3-methylbutanamide |
|---|---|
| PubChem CID | 123781945 |
| Molecular Formula | C24H33N3O2 |
| Molecular Weight | 395.55 g/mol |
| Exact Mass | 395.26 |
| IUPAC Name | N-[3-(2-cyclohexylethyl)-5-[4-(hydroxymethyl)phenyl]pyrazin-2-yl]-3-methylbutanamide |
| SMILES | CC(C)CC(=O)Nc1ncc(-c2ccc(CO)cc2)nc1CCC1CCCCC1 |
| InChI | InChI=1S/C24H33N3O2/c1-17(2)14-23(29)27-24-21(13-10-18-6-4-3-5-7-18)26-22(15-25-24)20-11-8-19(16-28)9-12-20/h8-9,11-12,15,17-18,28H,3-7,10,13-14,16H2,1-2H3,(H,25,27,29) |
| InChIKey | AQCHIZXGZGXEBX-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.55 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |