C23H32N4O — CID 89009351
N-[5-(4-aminophenyl)-3-(2-cyclohexylethyl)pyrazin-2-yl]-3-methylbutanamide (PubChem CID 89009351) has the molecular formula C23H32N4O and a molecular weight of 380.54 g/mol. Its IUPAC name is N-[5-(4-aminophenyl)-3-(2-cyclohexylethyl)pyrazin-2-yl]-3-methylbutanamide.
| Compound Name | N-[5-(4-aminophenyl)-3-(2-cyclohexylethyl)pyrazin-2-yl]-3-methylbutanamide |
|---|---|
| PubChem CID | 89009351 |
| Molecular Formula | C23H32N4O |
| Molecular Weight | 380.54 g/mol |
| Exact Mass | 380.26 |
| IUPAC Name | N-[5-(4-aminophenyl)-3-(2-cyclohexylethyl)pyrazin-2-yl]-3-methylbutanamide |
| SMILES | CC(C)CC(=O)Nc1ncc(-c2ccc(N)cc2)nc1CCC1CCCCC1 |
| InChI | InChI=1S/C23H32N4O/c1-16(2)14-22(28)27-23-20(13-8-17-6-4-3-5-7-17)26-21(15-25-23)18-9-11-19(24)12-10-18/h9-12,15-17H,3-8,13-14,24H2,1-2H3,(H,25,27,28) |
| InChIKey | ISMHIQBIDHWGPE-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.54 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|