C26H16F5N3O — CID 140639364
2-(2,3,4,5,6-pentafluorophenyl)-N-[5-phenyl-3-[(E)-2-phenylethenyl]pyrazin-2-yl]acetamide (PubChem CID 140639364) has the molecular formula C26H16F5N3O and a molecular weight of 481.42 g/mol. Its IUPAC name is 2-(2,3,4,5,6-pentafluorophenyl)-N-[5-phenyl-3-[(E)-2-phenylethenyl]pyrazin-2-yl]acetamide.
| Compound Name | 2-(2,3,4,5,6-pentafluorophenyl)-N-[5-phenyl-3-[(E)-2-phenylethenyl]pyrazin-2-yl]acetamide |
|---|---|
| PubChem CID | 140639364 |
| Molecular Formula | C26H16F5N3O |
| Molecular Weight | 481.42 g/mol |
| Exact Mass | 481.12 |
| IUPAC Name | 2-(2,3,4,5,6-pentafluorophenyl)-N-[5-phenyl-3-[(E)-2-phenylethenyl]pyrazin-2-yl]acetamide |
| SMILES | O=C(Cc1c(F)c(F)c(F)c(F)c1F)Nc1ncc(-c2ccccc2)nc1/C=C/c1ccccc1 |
| InChI | InChI=1S/C26H16F5N3O/c27-21-17(22(28)24(30)25(31)23(21)29)13-20(35)34-26-18(12-11-15-7-3-1-4-8-15)33-19(14-32-26)16-9-5-2-6-10-16/h1-12,14H,13H2,(H,32,34,35)/b12-11+ |
| InChIKey | IYRUMZULZOJCMG-VAWYXSNFSA-N |
| XLogP | 6.19 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.42 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|